C36H34NO4+ — CID 71455031
3,4,10,11-tetramethoxy-2-(4-phenylphenyl)-8-propan-2-ylisoquinolino[2,1-b]isoquinolin-7-ium (PubChem CID 71455031) has the molecular formula C36H34NO4+ and a molecular weight of 544.67 g/mol. Its IUPAC name is 3,4,10,11-tetramethoxy-2-(4-phenylphenyl)-8-propan-2-ylisoquinolino[2,1-b]isoquinolin-7-ium.
| Compound Name | 3,4,10,11-tetramethoxy-2-(4-phenylphenyl)-8-propan-2-ylisoquinolino[2,1-b]isoquinolin-7-ium |
|---|---|
| PubChem CID | 71455031 |
| Molecular Formula | C36H34NO4+ |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 3,4,10,11-tetramethoxy-2-(4-phenylphenyl)-8-propan-2-ylisoquinolino[2,1-b]isoquinolin-7-ium |
| SMILES | COc1cc2cc3c4cc(-c5ccc(-c6ccccc6)cc5)c(OC)c(OC)c4cc[n+]3c(C(C)C)c2cc1OC |
| InChI | InChI=1S/C36H34NO4/c1-22(2)34-28-21-33(39-4)32(38-3)19-26(28)18-31-30-20-29(36(41-6)35(40-5)27(30)16-17-37(31)34)25-14-12-24(13-15-25)23-10-8-7-9-11-23/h7-22H,1-6H3/q+1 |
| InChIKey | UBGSWUKLLJMRCX-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 41.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|