C30H29NO9S — CID 71462213
acetyl sulfate;3,4,10,11-tetramethoxy-8-methyl-2-phenylisoquinolino[2,1-b]isoquinolin-7-ium (PubChem CID 71462213) has the molecular formula C30H29NO9S and a molecular weight of 579.63 g/mol. Its IUPAC name is acetyl sulfate;3,4,10,11-tetramethoxy-8-methyl-2-phenylisoquinolino[2,1-b]isoquinolin-7-ium.
| Compound Name | acetyl sulfate;3,4,10,11-tetramethoxy-8-methyl-2-phenylisoquinolino[2,1-b]isoquinolin-7-ium |
|---|---|
| PubChem CID | 71462213 |
| Molecular Formula | C30H29NO9S |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | acetyl sulfate;3,4,10,11-tetramethoxy-8-methyl-2-phenylisoquinolino[2,1-b]isoquinolin-7-ium |
| SMILES | CC(=O)OS(=O)(=O)[O-].COc1cc2cc3c4cc(-c5ccccc5)c(OC)c(OC)c4cc[n+]3c(C)c2cc1OC |
| InChI | InChI=1S/C28H26NO4.C2H4O5S/c1-17-21-16-26(31-3)25(30-2)14-19(21)13-24-23-15-22(18-9-7-6-8-10-18)28(33-5)27(32-4)20(23)11-12-29(17)24;1-2(3)7-8(4,5)6/h6-16H,1-5H3;1H3,(H,4,5,6)/q+1;/p-1 |
| InChIKey | MSGXBXSCXLCALU-UHFFFAOYSA-M |
| XLogP | 4.75 |
| TPSA | 124.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|