C36H30O5 — CID 3392783
1-(2,3,9,10-tetramethoxy-5,12-diphenylbenzo[a]anthracen-7-yl)ethanone (PubChem CID 3392783) has the molecular formula C36H30O5 and a molecular weight of 542.63 g/mol. Its IUPAC name is 1-(2,3,9,10-tetramethoxy-5,12-diphenylbenzo[a]anthracen-7-yl)ethanone.
| Compound Name | 1-(2,3,9,10-tetramethoxy-5,12-diphenylbenzo[a]anthracen-7-yl)ethanone |
|---|---|
| PubChem CID | 3392783 |
| Molecular Formula | C36H30O5 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 1-(2,3,9,10-tetramethoxy-5,12-diphenylbenzo[a]anthracen-7-yl)ethanone |
| SMILES | COc1cc2c(C(C)=O)c3cc(-c4ccccc4)c4cc(OC)c(OC)cc4c3c(-c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C36H30O5/c1-21(37)34-27-19-32(40-4)33(41-5)20-28(27)35(23-14-10-7-11-15-23)36-26-18-31(39-3)30(38-2)17-25(26)24(16-29(34)36)22-12-8-6-9-13-22/h6-20H,1-5H3 |
| InChIKey | LBGNKCZQRJTFKE-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|