C25H23NO2 — CID 56698567
6,7-dimethoxy-N-methyl-3,4-diphenylnaphthalen-1-amine (PubChem CID 56698567) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 6,7-dimethoxy-N-methyl-3,4-diphenylnaphthalen-1-amine.
| Compound Name | 6,7-dimethoxy-N-methyl-3,4-diphenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 56698567 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 6,7-dimethoxy-N-methyl-3,4-diphenylnaphthalen-1-amine |
| SMILES | CNc1cc(-c2ccccc2)c(-c2ccccc2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C25H23NO2/c1-26-22-14-19(17-10-6-4-7-11-17)25(18-12-8-5-9-13-18)21-16-24(28-3)23(27-2)15-20(21)22/h4-16,26H,1-3H3 |
| InChIKey | WKCUONJXWDIECH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |