C20H20BrNO3 — CID 139214699
2-(6,7-dimethoxy-1-methylisoquinolin-2-ium-2-yl)-1-phenylethanone bromide (PubChem CID 139214699) has the molecular formula C20H20BrNO3 and a molecular weight of 402.29 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-1-methylisoquinolin-2-ium-2-yl)-1-phenylethanone bromide.
| Compound Name | 2-(6,7-dimethoxy-1-methylisoquinolin-2-ium-2-yl)-1-phenylethanone bromide |
|---|---|
| PubChem CID | 139214699 |
| Molecular Formula | C20H20BrNO3 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 2-(6,7-dimethoxy-1-methylisoquinolin-2-ium-2-yl)-1-phenylethanone bromide |
| SMILES | COc1cc2cc[n+](CC(=O)c3ccccc3)c(C)c2cc1OC.[Br-] |
| InChI | InChI=1S/C20H20NO3.BrH/c1-14-17-12-20(24-3)19(23-2)11-16(17)9-10-21(14)13-18(22)15-7-5-4-6-8-15;/h4-12H,13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WSAPVCCSJJJFAA-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|