C28H27N2O7+ — CID 17139511
2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]-1-(4-nitrophenyl)ethanone (PubChem CID 17139511) has the molecular formula C28H27N2O7+ and a molecular weight of 503.53 g/mol. Its IUPAC name is 2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 17139511 |
| Molecular Formula | C28H27N2O7+ |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]-1-(4-nitrophenyl)ethanone |
| SMILES | COc1ccc(Cc2c3cc(OC)c(OC)cc3cc[n+]2CC(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C28H27N2O7/c1-34-25-10-5-18(14-26(25)35-2)13-23-22-16-28(37-4)27(36-3)15-20(22)11-12-29(23)17-24(31)19-6-8-21(9-7-19)30(32)33/h5-12,14-16H,13,17H2,1-4H3/q+1 |
| InChIKey | UAZPZKWASOOQDI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 101.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|