C23H26NO5+ — CID 2172724
1-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]propan-2-one (PubChem CID 2172724) has the molecular formula C23H26NO5+ and a molecular weight of 396.46 g/mol. Its IUPAC name is 1-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]propan-2-one.
| Compound Name | 1-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]propan-2-one |
|---|---|
| PubChem CID | 2172724 |
| Molecular Formula | C23H26NO5+ |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]propan-2-one |
| SMILES | COc1ccc(Cc2c3cc(OC)c(OC)cc3cc[n+]2CC(C)=O)cc1OC |
| InChI | InChI=1S/C23H26NO5/c1-15(25)14-24-9-8-17-12-22(28-4)23(29-5)13-18(17)19(24)10-16-6-7-20(26-2)21(11-16)27-3/h6-9,11-13H,10,14H2,1-5H3/q+1 |
| InChIKey | WVHHTWAKXHTDGP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|