C18H17NO3 — CID 11000922
1-[(3,4-dimethoxyphenyl)methyl]-2-oxidoisoquinolin-2-ium (PubChem CID 11000922) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-oxidoisoquinolin-2-ium.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-oxidoisoquinolin-2-ium |
|---|---|
| PubChem CID | 11000922 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-oxidoisoquinolin-2-ium |
| SMILES | COc1ccc(Cc2c3ccccc3cc[n+]2[O-])cc1OC |
| InChI | InChI=1S/C18H17NO3/c1-21-17-8-7-13(12-18(17)22-2)11-16-15-6-4-3-5-14(15)9-10-19(16)20/h3-10,12H,11H2,1-2H3 |
| InChIKey | OMJFFTCTRKUNSR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|