C19H17N2O2+ — CID 5156634
2-[(3,4-dimethoxyphenyl)methyl]isoquinolin-2-ium-1-carbonitrile (PubChem CID 5156634) has the molecular formula C19H17N2O2+ and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]isoquinolin-2-ium-1-carbonitrile.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]isoquinolin-2-ium-1-carbonitrile |
|---|---|
| PubChem CID | 5156634 |
| Molecular Formula | C19H17N2O2+ |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]isoquinolin-2-ium-1-carbonitrile |
| SMILES | COc1ccc(C[n+]2ccc3ccccc3c2C#N)cc1OC |
| InChI | InChI=1S/C19H17N2O2/c1-22-18-8-7-14(11-19(18)23-2)13-21-10-9-15-5-3-4-6-16(15)17(21)12-20/h3-11H,13H2,1-2H3/q+1 |
| InChIKey | IRFVDAJXNRVXKO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|