C17H20BrNO5 — CID 46914424
methyl 1-[(3,4-dimethoxyphenyl)methyl]-4-methoxypyridin-1-ium-2-carboxylate bromide (PubChem CID 46914424) has the molecular formula C17H20BrNO5 and a molecular weight of 398.25 g/mol. Its IUPAC name is methyl 1-[(3,4-dimethoxyphenyl)methyl]-4-methoxypyridin-1-ium-2-carboxylate bromide.
| Compound Name | methyl 1-[(3,4-dimethoxyphenyl)methyl]-4-methoxypyridin-1-ium-2-carboxylate bromide |
|---|---|
| PubChem CID | 46914424 |
| Molecular Formula | C17H20BrNO5 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | methyl 1-[(3,4-dimethoxyphenyl)methyl]-4-methoxypyridin-1-ium-2-carboxylate bromide |
| SMILES | COC(=O)c1cc(OC)cc[n+]1Cc1ccc(OC)c(OC)c1.[Br-] |
| InChI | InChI=1S/C17H20NO5.BrH/c1-20-13-7-8-18(14(10-13)17(19)23-4)11-12-5-6-15(21-2)16(9-12)22-3;/h5-10H,11H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZQQJMWIINPCHQF-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|