C17H16F2N2O5 — CID 55612063
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-methyl-4-nitrobenzamide (PubChem CID 55612063) has the molecular formula C17H16F2N2O5 and a molecular weight of 366.32 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-methyl-4-nitrobenzamide.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 55612063 |
| Molecular Formula | C17H16F2N2O5 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-methyl-4-nitrobenzamide |
| SMILES | COc1ccc(CN(C)C(=O)c2ccc([N+](=O)[O-])cc2)cc1OC(F)F |
| InChI | InChI=1S/C17H16F2N2O5/c1-20(16(22)12-4-6-13(7-5-12)21(23)24)10-11-3-8-14(25-2)15(9-11)26-17(18)19/h3-9,17H,10H2,1-2H3 |
| InChIKey | UMJFXXRMLJGNDC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|