C18H20F2N2O5S — CID 56550038
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-methyl-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56550038) has the molecular formula C18H20F2N2O5S and a molecular weight of 414.43 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-methyl-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-methyl-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56550038 |
| Molecular Formula | C18H20F2N2O5S |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-methyl-2-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc(CN(C)C(=O)Cc2ccc(S(N)(=O)=O)cc2)cc1OC(F)F |
| InChI | InChI=1S/C18H20F2N2O5S/c1-22(11-13-5-8-15(26-2)16(9-13)27-18(19)20)17(23)10-12-3-6-14(7-4-12)28(21,24)25/h3-9,18H,10-11H2,1-2H3,(H2,21,24,25) |
| InChIKey | CGIMHRPZDHSJCI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |