C15H22F2N2O4 — CID 119717111
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-(2-methoxyethylamino)-N-methylacetamide (PubChem CID 119717111) has the molecular formula C15H22F2N2O4 and a molecular weight of 332.35 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-(2-methoxyethylamino)-N-methylacetamide.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-(2-methoxyethylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 119717111 |
| Molecular Formula | C15H22F2N2O4 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-(2-methoxyethylamino)-N-methylacetamide |
| SMILES | COCCNCC(=O)N(C)Cc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C15H22F2N2O4/c1-19(14(20)9-18-6-7-21-2)10-11-4-5-12(22-3)13(8-11)23-15(16)17/h4-5,8,15,18H,6-7,9-10H2,1-3H3 |
| InChIKey | JQLPWKHARDNXCA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|