C22H24F2N2O3 — CID 31884295
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-(2,5-dimethyl-1H-indol-3-yl)-N-methylacetamide (PubChem CID 31884295) has the molecular formula C22H24F2N2O3 and a molecular weight of 402.44 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-(2,5-dimethyl-1H-indol-3-yl)-N-methylacetamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-(2,5-dimethyl-1H-indol-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 31884295 |
| Molecular Formula | C22H24F2N2O3 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-(2,5-dimethyl-1H-indol-3-yl)-N-methylacetamide |
| SMILES | COc1cc(CN(C)C(=O)Cc2c(C)[nH]c3ccc(C)cc23)ccc1OC(F)F |
| InChI | InChI=1S/C22H24F2N2O3/c1-13-5-7-18-17(9-13)16(14(2)25-18)11-21(27)26(3)12-15-6-8-19(29-22(23)24)20(10-15)28-4/h5-10,22,25H,11-12H2,1-4H3 |
| InChIKey | IZVZRKKJQQEZIM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|