C19H20F2N2O4 — CID 112842490
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-[(3-nitrophenyl)methyl]cyclopropanamine (PubChem CID 112842490) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-[(3-nitrophenyl)methyl]cyclopropanamine.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-[(3-nitrophenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 112842490 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-[(3-nitrophenyl)methyl]cyclopropanamine |
| SMILES | COc1ccc(CN(Cc2cccc([N+](=O)[O-])c2)C2CC2)cc1OC(F)F |
| InChI | InChI=1S/C19H20F2N2O4/c1-26-17-8-5-14(10-18(17)27-19(20)21)12-22(15-6-7-15)11-13-3-2-4-16(9-13)23(24)25/h2-5,8-10,15,19H,6-7,11-12H2,1H3 |
| InChIKey | CPSJJKAUTSXOIN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|