C11H11F3N2O2 — CID 71650369
N-[(3-nitrophenyl)methyl]-N-(trifluoromethyl)cyclopropanamine (PubChem CID 71650369) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is N-[(3-nitrophenyl)methyl]-N-(trifluoromethyl)cyclopropanamine.
| Compound Name | N-[(3-nitrophenyl)methyl]-N-(trifluoromethyl)cyclopropanamine |
|---|---|
| PubChem CID | 71650369 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-[(3-nitrophenyl)methyl]-N-(trifluoromethyl)cyclopropanamine |
| SMILES | O=[N+]([O-])c1cccc(CN(C2CC2)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2O2/c12-11(13,14)15(9-4-5-9)7-8-2-1-3-10(6-8)16(17)18/h1-3,6,9H,4-5,7H2 |
| InChIKey | UQLXDVWUPXHHBQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|