C15H17F3N2O3 — CID 122145985
N-cyclopentyl-2-(3-nitrophenyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 122145985) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is N-cyclopentyl-2-(3-nitrophenyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-cyclopentyl-2-(3-nitrophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 122145985 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-cyclopentyl-2-(3-nitrophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cc1cccc([N+](=O)[O-])c1)N(CC(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C15H17F3N2O3/c16-15(17,18)10-19(12-5-1-2-6-12)14(21)9-11-4-3-7-13(8-11)20(22)23/h3-4,7-8,12H,1-2,5-6,9-10H2 |
| InChIKey | POUJXGBYGGCWTI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|