C19H17F2N5O5 — CID 31801115
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 31801115) has the molecular formula C19H17F2N5O5 and a molecular weight of 433.37 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 31801115 |
| Molecular Formula | C19H17F2N5O5 |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | COc1cc(CN(C)C(=O)c2ccc(-n3cncn3)c([N+](=O)[O-])c2)ccc1OC(F)F |
| InChI | InChI=1S/C19H17F2N5O5/c1-24(9-12-3-6-16(31-19(20)21)17(7-12)30-2)18(27)13-4-5-14(15(8-13)26(28)29)25-11-22-10-23-25/h3-8,10-11,19H,9H2,1-2H3 |
| InChIKey | PIUGZLGLQCRMEV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 112.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|