C18H16ClN5O4 — CID 33163839
N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 33163839) has the molecular formula C18H16ClN5O4 and a molecular weight of 401.81 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 33163839 |
| Molecular Formula | C18H16ClN5O4 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | COc1ccc(Cl)cc1CN(C)C(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16ClN5O4/c1-22(9-13-7-14(19)4-6-17(13)28-2)18(25)12-3-5-15(16(8-12)24(26)27)23-11-20-10-21-23/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | RXYPVHSDHWQGHF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|