C28H26BrN2O7+ — CID 17255920
2-[1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]-1-(4-nitrophenyl)ethanone (PubChem CID 17255920) has the molecular formula C28H26BrN2O7+ and a molecular weight of 582.43 g/mol. Its IUPAC name is 2-[1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-[1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 17255920 |
| Molecular Formula | C28H26BrN2O7+ |
| Molecular Weight | 582.43 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | 2-[1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium-2-yl]-1-(4-nitrophenyl)ethanone |
| SMILES | COc1cc(Br)c(Cc2c3cc(OC)c(OC)cc3cc[n+]2CC(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C28H26BrN2O7/c1-35-25-12-18-9-10-30(16-24(32)17-5-7-20(8-6-17)31(33)34)23(21(18)14-27(25)37-3)11-19-13-26(36-2)28(38-4)15-22(19)29/h5-10,12-15H,11,16H2,1-4H3/q+1 |
| InChIKey | LMIWJSDADIEWTQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 101.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|