C16H19N2O2+ — CID 3094228
2-(4-amino-2,3-dimethylpyridin-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone (PubChem CID 3094228) has the molecular formula C16H19N2O2+ and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-(4-amino-2,3-dimethylpyridin-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-(4-amino-2,3-dimethylpyridin-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 3094228 |
| Molecular Formula | C16H19N2O2+ |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-(4-amino-2,3-dimethylpyridin-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)C[n+]2ccc(N)c(C)c2C)cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-11-12(2)18(9-8-15(11)17)10-16(19)13-4-6-14(20-3)7-5-13/h4-9,17H,10H2,1-3H3/p+1 |
| InChIKey | LSKHBSODWYCLIB-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|