C18H20BrN3O2 — CID 2859118
2-(3-amino-5,6-dimethylbenzimidazol-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone bromide (PubChem CID 2859118) has the molecular formula C18H20BrN3O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is 2-(3-amino-5,6-dimethylbenzimidazol-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone bromide.
| Compound Name | 2-(3-amino-5,6-dimethylbenzimidazol-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone bromide |
|---|---|
| PubChem CID | 2859118 |
| Molecular Formula | C18H20BrN3O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-(3-amino-5,6-dimethylbenzimidazol-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone bromide |
| SMILES | COc1ccc(C(=O)C[n+]2cn(N)c3cc(C)c(C)cc32)cc1.[Br-] |
| InChI | InChI=1S/C18H20N3O2.BrH/c1-12-8-16-17(9-13(12)2)21(19)11-20(16)10-18(22)14-4-6-15(23-3)7-5-14;/h4-9,11H,10,19H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LLAPWBOWIZCDHT-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|