C35H34NO4+ — CID 90897948
[2-(3,4-dimethoxy-2-methylphenyl)-6,7-dimethoxy-3-(4-phenylphenyl)naphthalen-1-yl]-methyl-methylideneazanium (PubChem CID 90897948) has the molecular formula C35H34NO4+ and a molecular weight of 532.66 g/mol. Its IUPAC name is [2-(3,4-dimethoxy-2-methylphenyl)-6,7-dimethoxy-3-(4-phenylphenyl)naphthalen-1-yl]-methyl-methylideneazanium.
| Compound Name | [2-(3,4-dimethoxy-2-methylphenyl)-6,7-dimethoxy-3-(4-phenylphenyl)naphthalen-1-yl]-methyl-methylideneazanium |
|---|---|
| PubChem CID | 90897948 |
| Molecular Formula | C35H34NO4+ |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | [2-(3,4-dimethoxy-2-methylphenyl)-6,7-dimethoxy-3-(4-phenylphenyl)naphthalen-1-yl]-methyl-methylideneazanium |
| SMILES | C=[N+](C)c1c(-c2ccc(OC)c(OC)c2C)c(-c2ccc(-c3ccccc3)cc2)cc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C35H34NO4/c1-22-27(17-18-30(37-4)35(22)40-7)33-28(25-15-13-24(14-16-25)23-11-9-8-10-12-23)19-26-20-31(38-5)32(39-6)21-29(26)34(33)36(2)3/h8-21H,2H2,1,3-7H3/q+1 |
| InChIKey | OCEYGEHIZKWSIY-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|