C25H22O4 — CID 102302660
6,7,8-trimethoxy-1,3-diphenylnaphthalen-2-ol (PubChem CID 102302660) has the molecular formula C25H22O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 6,7,8-trimethoxy-1,3-diphenylnaphthalen-2-ol.
| Compound Name | 6,7,8-trimethoxy-1,3-diphenylnaphthalen-2-ol |
|---|---|
| PubChem CID | 102302660 |
| Molecular Formula | C25H22O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 6,7,8-trimethoxy-1,3-diphenylnaphthalen-2-ol |
| SMILES | COc1cc2cc(-c3ccccc3)c(O)c(-c3ccccc3)c2c(OC)c1OC |
| InChI | InChI=1S/C25H22O4/c1-27-20-15-18-14-19(16-10-6-4-7-11-16)23(26)21(17-12-8-5-9-13-17)22(18)25(29-3)24(20)28-2/h4-15,26H,1-3H3 |
| InChIKey | HCAOKXCTUJOKTK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |