C28H32ClNO3 — CID 160544288
1-cyclohexyl-2,3,7-trimethoxy-5,8-dimethylbenzo[c]phenanthridin-5-ium chloride (PubChem CID 160544288) has the molecular formula C28H32ClNO3 and a molecular weight of 466.02 g/mol. Its IUPAC name is 1-cyclohexyl-2,3,7-trimethoxy-5,8-dimethylbenzo[c]phenanthridin-5-ium chloride.
| Compound Name | 1-cyclohexyl-2,3,7-trimethoxy-5,8-dimethylbenzo[c]phenanthridin-5-ium chloride |
|---|---|
| PubChem CID | 160544288 |
| Molecular Formula | C28H32ClNO3 |
| Molecular Weight | 466.02 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 1-cyclohexyl-2,3,7-trimethoxy-5,8-dimethylbenzo[c]phenanthridin-5-ium chloride |
| SMILES | COc1cc2c(ccc3c4ccc(C)c(OC)c4c[n+](C)c23)c(C2CCCCC2)c1OC.[Cl-] |
| InChI | InChI=1S/C28H32NO3.ClH/c1-17-11-12-19-21-14-13-20-22(26(21)29(2)16-23(19)27(17)31-4)15-24(30-3)28(32-5)25(20)18-9-7-6-8-10-18;/h11-16,18H,6-10H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | ZJAQRWVETJQWFO-UHFFFAOYSA-M |
| XLogP | 3.36 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.02 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|