C23H22NO5+ — CID 102594482
3-ethoxy-1,2-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium (PubChem CID 102594482) has the molecular formula C23H22NO5+ and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-ethoxy-1,2-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium.
| Compound Name | 3-ethoxy-1,2-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium |
|---|---|
| PubChem CID | 102594482 |
| Molecular Formula | C23H22NO5+ |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-ethoxy-1,2-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium |
| SMILES | CCOc1cc2c(c[n+](C)c3c4cc5c(cc4ccc23)OCO5)c(OC)c1OC |
| InChI | InChI=1S/C23H22NO5/c1-5-27-20-10-16-14-7-6-13-8-18-19(29-12-28-18)9-15(13)21(14)24(2)11-17(16)22(25-3)23(20)26-4/h6-11H,5,12H2,1-4H3/q+1 |
| InChIKey | OCHVEIWLDXUQEC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|