C23H19NO7 — CID 22155076
2-hydroxypropanoate;24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene (PubChem CID 22155076) has the molecular formula C23H19NO7 and a molecular weight of 421.41 g/mol. Its IUPAC name is 2-hydroxypropanoate;24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene.
| Compound Name | 2-hydroxypropanoate;24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene |
|---|---|
| PubChem CID | 22155076 |
| Molecular Formula | C23H19NO7 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-hydroxypropanoate;24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene |
| SMILES | CC(O)C(=O)[O-].C[n+]1cc2c3c(ccc2c2ccc4cc5c(cc4c21)OCO5)OCO3 |
| InChI | InChI=1S/C20H14NO4.C3H6O3/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21;1-2(4)3(5)6/h2-8H,9-10H2,1H3;2,4H,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | FEMCLRMCBLQEAU-UHFFFAOYSA-M |
| XLogP | 1.55 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|