C27H20NO4+ — CID 58064966
12-benzyl-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1,3,8,10,12,14(22),15,17(21),23-nonaene (PubChem CID 58064966) has the molecular formula C27H20NO4+ and a molecular weight of 422.46 g/mol. Its IUPAC name is 12-benzyl-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1,3,8,10,12,14(22),15,17(21),23-nonaene.
| Compound Name | 12-benzyl-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1,3,8,10,12,14(22),15,17(21),23-nonaene |
|---|---|
| PubChem CID | 58064966 |
| Molecular Formula | C27H20NO4+ |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 12-benzyl-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1,3,8,10,12,14(22),15,17(21),23-nonaene |
| SMILES | C[n+]1cc2c3c(ccc2c2c(Cc4ccccc4)cc4cc5c(cc4c21)OCO5)OCO3 |
| InChI | InChI=1S/C27H20NO4/c1-28-13-21-19(7-8-22-27(21)32-15-29-22)25-18(9-16-5-3-2-4-6-16)10-17-11-23-24(31-14-30-23)12-20(17)26(25)28/h2-8,10-13H,9,14-15H2,1H3/q+1 |
| InChIKey | OFTVOIXCBUNLCF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|