C20H16NO4+ — CID 66720564
9-methoxy-6-methyl-[1,3]benzodioxolo[7,6-c]phenanthridin-6-ium-8-ol (PubChem CID 66720564) has the molecular formula C20H16NO4+ and a molecular weight of 334.35 g/mol. Its IUPAC name is 9-methoxy-6-methyl-[1,3]benzodioxolo[7,6-c]phenanthridin-6-ium-8-ol.
| Compound Name | 9-methoxy-6-methyl-[1,3]benzodioxolo[7,6-c]phenanthridin-6-ium-8-ol |
|---|---|
| PubChem CID | 66720564 |
| Molecular Formula | C20H16NO4+ |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 9-methoxy-6-methyl-[1,3]benzodioxolo[7,6-c]phenanthridin-6-ium-8-ol |
| SMILES | COc1ccc2c(c[n+](C)c3c4ccc5c(c4ccc23)OCO5)c1O |
| InChI | InChI=1S/C20H15NO4/c1-21-9-15-11(5-7-16(23-2)19(15)22)12-3-4-14-13(18(12)21)6-8-17-20(14)25-10-24-17/h3-9H,10H2,1-2H3/p+1 |
| InChIKey | VTJXCKCDLMWNRM-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|