C23H19ClNO5+ — CID 71532403
(5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) acetate;hydrochloride (PubChem CID 71532403) has the molecular formula C23H19ClNO5+ and a molecular weight of 424.86 g/mol. Its IUPAC name is (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) acetate;hydrochloride.
| Compound Name | (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) acetate;hydrochloride |
|---|---|
| PubChem CID | 71532403 |
| Molecular Formula | C23H19ClNO5+ |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) acetate;hydrochloride |
| SMILES | COc1ccc2c(c[n+]3c4c2ccc2c5c(cc(c24)CC3)OCO5)c1OC(C)=O.Cl |
| InChI | InChI=1S/C23H18NO5.ClH/c1-12(25)29-23-17-10-24-8-7-13-9-19-22(28-11-27-19)16-4-3-15(21(24)20(13)16)14(17)5-6-18(23)26-2;/h3-6,9-10H,7-8,11H2,1-2H3;1H/q+1; |
| InChIKey | ZOUCCWNQJGRTRD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|