C25H22NO4+ — CID 155530446
5,6-dimethoxy-8-prop-2-enyl-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene (PubChem CID 155530446) has the molecular formula C25H22NO4+ and a molecular weight of 400.45 g/mol. Its IUPAC name is 5,6-dimethoxy-8-prop-2-enyl-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene.
| Compound Name | 5,6-dimethoxy-8-prop-2-enyl-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene |
|---|---|
| PubChem CID | 155530446 |
| Molecular Formula | C25H22NO4+ |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 5,6-dimethoxy-8-prop-2-enyl-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene |
| SMILES | C=CCc1c2c(OC)c(OC)ccc2c2ccc3c4c(cc5c3c2[n+]1CC5)OCO4 |
| InChI | InChI=1S/C25H22NO4/c1-4-5-18-22-15(8-9-19(27-2)25(22)28-3)16-6-7-17-21-14(10-11-26(18)23(16)21)12-20-24(17)30-13-29-20/h4,6-9,12H,1,5,10-11,13H2,2-3H3/q+1 |
| InChIKey | QGDNIOYCMGCKJY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|