C29H23ClNO6+ — CID 71531986
(5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 3-methoxybenzoate;hydrochloride (PubChem CID 71531986) has the molecular formula C29H23ClNO6+ and a molecular weight of 516.96 g/mol. Its IUPAC name is (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 3-methoxybenzoate;hydrochloride.
| Compound Name | (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 3-methoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 71531986 |
| Molecular Formula | C29H23ClNO6+ |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 3-methoxybenzoate;hydrochloride |
| SMILES | COc1cccc(C(=O)Oc2c(OC)ccc3c2c[n+]2c4c3ccc3c5c(cc(c34)CC2)OCO5)c1.Cl |
| InChI | InChI=1S/C29H22NO6.ClH/c1-32-18-5-3-4-17(12-18)29(31)36-28-22-14-30-11-10-16-13-24-27(35-15-34-24)21-7-6-20(26(30)25(16)21)19(22)8-9-23(28)33-2;/h3-9,12-14H,10-11,15H2,1-2H3;1H/q+1; |
| InChIKey | RNJVHWUBTCJJDW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 67.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|