C28H21BrClNO4 — CID 155531405
8-(4-chlorophenyl)-5,6-dimethoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene bromide (PubChem CID 155531405) has the molecular formula C28H21BrClNO4 and a molecular weight of 550.84 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-5,6-dimethoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene bromide.
| Compound Name | 8-(4-chlorophenyl)-5,6-dimethoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene bromide |
|---|---|
| PubChem CID | 155531405 |
| Molecular Formula | C28H21BrClNO4 |
| Molecular Weight | 550.84 g/mol |
| Exact Mass | 549.03 |
| IUPAC Name | 8-(4-chlorophenyl)-5,6-dimethoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene bromide |
| SMILES | COc1ccc2c(c1OC)c(-c1ccc(Cl)cc1)[n+]1c3c2ccc2c4c(cc(c23)CC1)OCO4.[Br-] |
| InChI | InChI=1S/C28H21ClNO4.BrH/c1-31-21-10-9-18-19-7-8-20-23-16(13-22-27(20)34-14-33-22)11-12-30(26(19)23)25(24(18)28(21)32-2)15-3-5-17(29)6-4-15;/h3-10,13H,11-12,14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | DZOIHQZAZPORIU-UHFFFAOYSA-M |
| XLogP | 3.06 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.84 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|