C32H31N2O2+ — CID 123670473
[2-(dimethylamino)-3-(3,5-diphenylphenyl)-7-(hydroxymethyl)-1-methylquinolin-1-ium-6-yl]methanol (PubChem CID 123670473) has the molecular formula C32H31N2O2+ and a molecular weight of 475.61 g/mol. Its IUPAC name is [2-(dimethylamino)-3-(3,5-diphenylphenyl)-7-(hydroxymethyl)-1-methylquinolin-1-ium-6-yl]methanol.
| Compound Name | [2-(dimethylamino)-3-(3,5-diphenylphenyl)-7-(hydroxymethyl)-1-methylquinolin-1-ium-6-yl]methanol |
|---|---|
| PubChem CID | 123670473 |
| Molecular Formula | C32H31N2O2+ |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | [2-(dimethylamino)-3-(3,5-diphenylphenyl)-7-(hydroxymethyl)-1-methylquinolin-1-ium-6-yl]methanol |
| SMILES | CN(C)c1c(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc2cc(CO)c(CO)cc2[n+]1C |
| InChI | InChI=1S/C32H31N2O2/c1-33(2)32-30(18-27-17-28(20-35)29(21-36)19-31(27)34(32)3)26-15-24(22-10-6-4-7-11-22)14-25(16-26)23-12-8-5-9-13-23/h4-19,35-36H,20-21H2,1-3H3/q+1 |
| InChIKey | JXYGHLDBEHIOLV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|