C29H28NO3+ — CID 70875923
1-benzyl-3,7,8-trimethoxy-2,5-dimethylbenzo[c]phenanthridin-5-ium (PubChem CID 70875923) has the molecular formula C29H28NO3+ and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-benzyl-3,7,8-trimethoxy-2,5-dimethylbenzo[c]phenanthridin-5-ium.
| Compound Name | 1-benzyl-3,7,8-trimethoxy-2,5-dimethylbenzo[c]phenanthridin-5-ium |
|---|---|
| PubChem CID | 70875923 |
| Molecular Formula | C29H28NO3+ |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-benzyl-3,7,8-trimethoxy-2,5-dimethylbenzo[c]phenanthridin-5-ium |
| SMILES | COc1cc2c(ccc3c4ccc(OC)c(OC)c4c[n+](C)c23)c(Cc2ccccc2)c1C |
| InChI | InChI=1S/C29H28NO3/c1-18-23(15-19-9-7-6-8-10-19)21-11-12-22-20-13-14-26(31-3)29(33-5)25(20)17-30(2)28(22)24(21)16-27(18)32-4/h6-14,16-17H,15H2,1-5H3/q+1 |
| InChIKey | XLXIDSWCSKJTJL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|