C33H29NO4 — CID 70875912
2,3,7,8-tetramethoxy-1-(4-phenylphenyl)-5,6-dihydrobenzo[c]phenanthridine (PubChem CID 70875912) has the molecular formula C33H29NO4 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2,3,7,8-tetramethoxy-1-(4-phenylphenyl)-5,6-dihydrobenzo[c]phenanthridine.
| Compound Name | 2,3,7,8-tetramethoxy-1-(4-phenylphenyl)-5,6-dihydrobenzo[c]phenanthridine |
|---|---|
| PubChem CID | 70875912 |
| Molecular Formula | C33H29NO4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 2,3,7,8-tetramethoxy-1-(4-phenylphenyl)-5,6-dihydrobenzo[c]phenanthridine |
| SMILES | COc1ccc2c(c1OC)CNc1c-2ccc2c(-c3ccc(-c4ccccc4)cc3)c(OC)c(OC)cc12 |
| InChI | InChI=1S/C33H29NO4/c1-35-28-17-16-23-25-15-14-24-26(31(25)34-19-27(23)32(28)37-3)18-29(36-2)33(38-4)30(24)22-12-10-21(11-13-22)20-8-6-5-7-9-20/h5-18,34H,19H2,1-4H3 |
| InChIKey | WEJCCEACSUEGTA-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |