C33H26BrNO3 — CID 91418436
5-bromo-N-[6,7-dimethoxy-5-(4-phenylphenyl)naphthalen-1-yl]-2-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-imine (PubChem CID 91418436) has the molecular formula C33H26BrNO3 and a molecular weight of 564.48 g/mol. Its IUPAC name is 5-bromo-N-[6,7-dimethoxy-5-(4-phenylphenyl)naphthalen-1-yl]-2-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-imine.
| Compound Name | 5-bromo-N-[6,7-dimethoxy-5-(4-phenylphenyl)naphthalen-1-yl]-2-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-imine |
|---|---|
| PubChem CID | 91418436 |
| Molecular Formula | C33H26BrNO3 |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | 5-bromo-N-[6,7-dimethoxy-5-(4-phenylphenyl)naphthalen-1-yl]-2-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-imine |
| SMILES | COc1ccc(Br)c2c1C/C2=N\c1cccc2c(-c3ccc(-c4ccccc4)cc3)c(OC)c(OC)cc12 |
| InChI | InChI=1S/C33H26BrNO3/c1-36-29-17-16-26(34)32-25(29)18-28(32)35-27-11-7-10-23-24(27)19-30(37-2)33(38-3)31(23)22-14-12-21(13-15-22)20-8-5-4-6-9-20/h4-17,19H,18H2,1-3H3/b35-28+ |
| InChIKey | KSUKRWFTOQAVMT-AWQADKOQSA-N |
| XLogP | 8.64 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|