C18H15NO3S — CID 88572567
4-(2,3-dimethoxy-5-nitrosonaphthalen-1-yl)benzenethiol (PubChem CID 88572567) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-(2,3-dimethoxy-5-nitrosonaphthalen-1-yl)benzenethiol.
| Compound Name | 4-(2,3-dimethoxy-5-nitrosonaphthalen-1-yl)benzenethiol |
|---|---|
| PubChem CID | 88572567 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 4-(2,3-dimethoxy-5-nitrosonaphthalen-1-yl)benzenethiol |
| SMILES | COc1cc2c(N=O)cccc2c(-c2ccc(S)cc2)c1OC |
| InChI | InChI=1S/C18H15NO3S/c1-21-16-10-14-13(4-3-5-15(14)19-20)17(18(16)22-2)11-6-8-12(23)9-7-11/h3-10,23H,1-2H3 |
| InChIKey | MGLBKGUWIYFVEK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|