C15H15BrO2 — CID 69450374
1-bromo-2,4-dimethoxy-3-(3-methylphenyl)benzene (PubChem CID 69450374) has the molecular formula C15H15BrO2 and a molecular weight of 307.19 g/mol. Its IUPAC name is 1-bromo-2,4-dimethoxy-3-(3-methylphenyl)benzene.
| Compound Name | 1-bromo-2,4-dimethoxy-3-(3-methylphenyl)benzene |
|---|---|
| PubChem CID | 69450374 |
| Molecular Formula | C15H15BrO2 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-bromo-2,4-dimethoxy-3-(3-methylphenyl)benzene |
| SMILES | COc1ccc(Br)c(OC)c1-c1cccc(C)c1 |
| InChI | InChI=1S/C15H15BrO2/c1-10-5-4-6-11(9-10)14-13(17-2)8-7-12(16)15(14)18-3/h4-9H,1-3H3 |
| InChIKey | RRWAICZUWSXZOH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |