C32H26NO5+ — CID 66619376
[6-(7,8-dimethoxy-2-methylisoquinolin-2-ium-3-yl)-1,3-benzodioxol-5-yl]-(4-phenylphenyl)methanone (PubChem CID 66619376) has the molecular formula C32H26NO5+ and a molecular weight of 504.56 g/mol. Its IUPAC name is [6-(7,8-dimethoxy-2-methylisoquinolin-2-ium-3-yl)-1,3-benzodioxol-5-yl]-(4-phenylphenyl)methanone.
| Compound Name | [6-(7,8-dimethoxy-2-methylisoquinolin-2-ium-3-yl)-1,3-benzodioxol-5-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 66619376 |
| Molecular Formula | C32H26NO5+ |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | [6-(7,8-dimethoxy-2-methylisoquinolin-2-ium-3-yl)-1,3-benzodioxol-5-yl]-(4-phenylphenyl)methanone |
| SMILES | COc1ccc2cc(-c3cc4c(cc3C(=O)c3ccc(-c5ccccc5)cc3)OCO4)[n+](C)cc2c1OC |
| InChI | InChI=1S/C32H26NO5/c1-33-18-26-23(13-14-28(35-2)32(26)36-3)15-27(33)24-16-29-30(38-19-37-29)17-25(24)31(34)22-11-9-21(10-12-22)20-7-5-4-6-8-20/h4-18H,19H2,1-3H3/q+1 |
| InChIKey | KYMZHKDYQBBFET-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|