C22H20NO6+ — CID 56947374
methyl 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene-12-carboxylate (PubChem CID 56947374) has the molecular formula C22H20NO6+ and a molecular weight of 394.40 g/mol. Its IUPAC name is methyl 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene-12-carboxylate.
| Compound Name | methyl 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene-12-carboxylate |
|---|---|
| PubChem CID | 56947374 |
| Molecular Formula | C22H20NO6+ |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | methyl 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene-12-carboxylate |
| SMILES | COC(=O)C1Cc2cc3c(cc2-c2cc4ccc(OC)c(OC)c4c[n+]21)OCO3 |
| InChI | InChI=1S/C22H20NO6/c1-25-18-5-4-12-6-16-14-9-20-19(28-11-29-20)8-13(14)7-17(22(24)27-3)23(16)10-15(12)21(18)26-2/h4-6,8-10,17H,7,11H2,1-3H3/q+1 |
| InChIKey | RXCAZRPEPTYXLI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|