C28H20F2IN — CID 158356293
3-[3,4-difluoro-5-(4-phenylphenyl)phenyl]-1-methylquinolin-1-ium iodide (PubChem CID 158356293) has the molecular formula C28H20F2IN and a molecular weight of 535.38 g/mol. Its IUPAC name is 3-[3,4-difluoro-5-(4-phenylphenyl)phenyl]-1-methylquinolin-1-ium iodide.
| Compound Name | 3-[3,4-difluoro-5-(4-phenylphenyl)phenyl]-1-methylquinolin-1-ium iodide |
|---|---|
| PubChem CID | 158356293 |
| Molecular Formula | C28H20F2IN |
| Molecular Weight | 535.38 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 3-[3,4-difluoro-5-(4-phenylphenyl)phenyl]-1-methylquinolin-1-ium iodide |
| SMILES | C[n+]1cc(-c2cc(F)c(F)c(-c3ccc(-c4ccccc4)cc3)c2)cc2ccccc21.[I-] |
| InChI | InChI=1S/C28H20F2N.HI/c1-31-18-24(15-22-9-5-6-10-27(22)31)23-16-25(28(30)26(29)17-23)21-13-11-20(12-14-21)19-7-3-2-4-8-19;/h2-18H,1H3;1H/q+1;/p-1 |
| InChIKey | KWKPPNXUZLAWBG-UHFFFAOYSA-M |
| XLogP | 3.95 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|