About 2-chloro-1-fluoro-3,5-diphenylbenzene
2-chloro-1-fluoro-3,5-diphenylbenzene (PubChem CID 23135570) has the molecular formula C18H12ClF
and a molecular weight of 282.75 g/mol. Its IUPAC name is 2-chloro-1-fluoro-3,5-diphenylbenzene.
Molecular Properties
| Compound Name | 2-chloro-1-fluoro-3,5-diphenylbenzene |
| PubChem CID | 23135570 |
| Molecular Formula | C18H12ClF |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-chloro-1-fluoro-3,5-diphenylbenzene |
| SMILES | Fc1cc(-c2ccccc2)cc(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C18H12ClF/c19-18-16(14-9-5-2-6-10-14)11-15(12-17(18)20)13-7-3-1-4-8-13/h1-12H |
| InChIKey | GREABHLUCSZQMP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-chloro-1-fluoro-3,5-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-fluoro-3,5-diphenylbenzene?
The IUPAC name of 2-chloro-1-fluoro-3,5-diphenylbenzene (CID 23135570) is 2-chloro-1-fluoro-3,5-diphenylbenzene.
What is the SMILES notation for 2-chloro-1-fluoro-3,5-diphenylbenzene?
The canonical SMILES for 2-chloro-1-fluoro-3,5-diphenylbenzene is Fc1cc(-c2ccccc2)cc(-c2ccccc2)c1Cl.
What is the InChIKey of 2-chloro-1-fluoro-3,5-diphenylbenzene?
The InChIKey is GREABHLUCSZQMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClF/c19-18-16(14-9-5-2-6-10-14)11-15(12-17(18)20)13-7-3-1-4-8-13/h1-12H.
What are the key properties of 2-chloro-1-fluoro-3,5-diphenylbenzene?
2-chloro-1-fluoro-3,5-diphenylbenzene has a molecular weight of 282.75 g/mol, XLogP of 5.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-fluoro-3,5-diphenylbenzene is sourced from PubChem (CID 23135570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).