C18H20O6 — CID 167151966
6-[1-(2,3,4-trimethoxyphenyl)ethyl]-1,3-benzodioxol-5-ol (PubChem CID 167151966) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 6-[1-(2,3,4-trimethoxyphenyl)ethyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[1-(2,3,4-trimethoxyphenyl)ethyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 167151966 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 6-[1-(2,3,4-trimethoxyphenyl)ethyl]-1,3-benzodioxol-5-ol |
| SMILES | COc1ccc(C(C)c2cc3c(cc2O)OCO3)c(OC)c1OC |
| InChI | InChI=1S/C18H20O6/c1-10(12-7-15-16(8-13(12)19)24-9-23-15)11-5-6-14(20-2)18(22-4)17(11)21-3/h5-8,10,19H,9H2,1-4H3 |
| InChIKey | OMJOTGDNSOSKGW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |