C21H21N3O6 — CID 7033143
6-[(S)-(pyrimidin-2-ylamino)-(3,4,5-trimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 7033143) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is 6-[(S)-(pyrimidin-2-ylamino)-(3,4,5-trimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(S)-(pyrimidin-2-ylamino)-(3,4,5-trimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 7033143 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 6-[(S)-(pyrimidin-2-ylamino)-(3,4,5-trimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | COc1cc([C@H](Nc2ncccn2)c2cc3c(cc2O)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C21H21N3O6/c1-26-17-7-12(8-18(27-2)20(17)28-3)19(24-21-22-5-4-6-23-21)13-9-15-16(10-14(13)25)30-11-29-15/h4-10,19,25H,11H2,1-3H3,(H,22,23,24)/t19-/m0/s1 |
| InChIKey | YPOUNHHTZWEASN-IBGZPJMESA-N |
| XLogP | 3.14 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|