C17H18O5 — CID 167151970
6-[1-(2,3-dimethoxyphenyl)ethyl]-1,3-benzodioxol-5-ol (PubChem CID 167151970) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 6-[1-(2,3-dimethoxyphenyl)ethyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[1-(2,3-dimethoxyphenyl)ethyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 167151970 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 6-[1-(2,3-dimethoxyphenyl)ethyl]-1,3-benzodioxol-5-ol |
| SMILES | COc1cccc(C(C)c2cc3c(cc2O)OCO3)c1OC |
| InChI | InChI=1S/C17H18O5/c1-10(11-5-4-6-14(19-2)17(11)20-3)12-7-15-16(8-13(12)18)22-9-21-15/h4-8,10,18H,9H2,1-3H3 |
| InChIKey | BMPJUANJBPURKZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |