C12H12N4O2 — CID 80920460
N-(1,3-benzodioxol-5-yl)-6-hydrazinylpyridin-2-amine (PubChem CID 80920460) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-hydrazinylpyridin-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 80920460 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-hydrazinylpyridin-2-amine |
| SMILES | NNc1cccc(Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C12H12N4O2/c13-16-12-3-1-2-11(15-12)14-8-4-5-9-10(6-8)18-7-17-9/h1-6H,7,13H2,(H2,14,15,16) |
| InChIKey | VAJLYLXQPVKJRV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|