C11H8ClN3O2 — CID 60727029
N-(1,3-benzodioxol-5-yl)-6-chloropyrimidin-4-amine (PubChem CID 60727029) has the molecular formula C11H8ClN3O2 and a molecular weight of 249.66 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-chloropyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 60727029 |
| Molecular Formula | C11H8ClN3O2 |
| Molecular Weight | 249.66 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-chloropyrimidin-4-amine |
| SMILES | Clc1cc(Nc2ccc3c(c2)OCO3)ncn1 |
| InChI | InChI=1S/C11H8ClN3O2/c12-10-4-11(14-5-13-10)15-7-1-2-8-9(3-7)17-6-16-8/h1-5H,6H2,(H,13,14,15) |
| InChIKey | NTCALHCLXZDZPT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |