C14H13ClN2O2 — CID 55027599
6-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyridin-2-amine (PubChem CID 55027599) has the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. Its IUPAC name is 6-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 55027599 |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 6-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyridin-2-amine |
| SMILES | Clc1cccc(Nc2ccc3c(c2)OCCCO3)n1 |
| InChI | InChI=1S/C14H13ClN2O2/c15-13-3-1-4-14(17-13)16-10-5-6-11-12(9-10)19-8-2-7-18-11/h1,3-6,9H,2,7-8H2,(H,16,17) |
| InChIKey | MOXYRAQCFZVOKM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|