C22H16N2O3 — CID 11245222
3-[1-(1,3-benzodioxol-5-ylamino)isoquinolin-5-yl]phenol (PubChem CID 11245222) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-[1-(1,3-benzodioxol-5-ylamino)isoquinolin-5-yl]phenol.
| Compound Name | 3-[1-(1,3-benzodioxol-5-ylamino)isoquinolin-5-yl]phenol |
|---|---|
| PubChem CID | 11245222 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-[1-(1,3-benzodioxol-5-ylamino)isoquinolin-5-yl]phenol |
| SMILES | Oc1cccc(-c2cccc3c(Nc4ccc5c(c4)OCO5)nccc23)c1 |
| InChI | InChI=1S/C22H16N2O3/c25-16-4-1-3-14(11-16)17-5-2-6-19-18(17)9-10-23-22(19)24-15-7-8-20-21(12-15)27-13-26-20/h1-12,25H,13H2,(H,23,24) |
| InChIKey | JIIOVILZEUPVSW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |